Menu
Unifiram (DM-232) is a highly potent AMPAkine-like nootropic with antiamnesic and cognition-enhancing effects at up to three orders of magnitude higher potency than piracetam.
From €39.28
Unifiram (DM-232) is a highly potent AMPAkine-like nootropic with antiamnesic and cognition-enhancing effects at up to three orders of magnitude higher potency than piracetam.
Unifiram (DM-232) is structurally similar to Sunifiram, and is a highly potent AMPAkine-line compound with effective cognition-enhancing and anti-amnesiac effects. Although sometimes grouped with racetam compounds, Unifiram is technically not a racetam due to the broken pyrrolidone backbone.
Unifiram, classified as an ampakine compound, belongs to a group known for elevating glutamate levels in the brain. Glutamate, crucial for learning, memory, and synaptic plasticity, potentially undergoes regulation through Unifiram’s mechanism. While the precise mode of action remains not totally understood, it is hypothesized that Unifiram hampers glutamate degradation, thereby elevating synaptic glutamate levels, ultimately enhancing cognitive function.
Unifiram triggers an increase in acetylcholine release in the cerebral cortex while generating a sustained rise in the amplitude of field excitatory postsynaptic potentials (fEPSPs) in the hippocampal CA1 region.
Unifiram is a powerful nootropic compound known for its potential cognitive-enhancing properties, offering benefits like improved memory, learning, and mental clarity. Structurally similar to ampakines, Unifiram is thought to stimulate neurotransmitters in the brain, potentially increasing synaptic plasticity and promoting heightened mental performance. This nootropic is often sought by those looking to boost focus, motivation, and overall cognitive function.
Unifiram (DM-232) is a highly potent AMPAkine-like nootropic with antiamnesic and cognition-enhancing effects at up to three orders of magnitude higher potency than piracetam.
Unifiram (DM-232) is structurally similar to Sunifiram, and is a highly potent AMPAkine-line compound with effective cognition-enhancing and anti-amnesiac effects. Although sometimes grouped with racetam compounds, Unifiram is technically not a racetam due to the broken pyrrolidone backbone.
Unifiram, classified as an ampakine compound, belongs to a group known for elevating glutamate levels in the brain. Glutamate, crucial for learning, memory, and synaptic plasticity, potentially undergoes regulation through Unifiram’s mechanism. While the precise mode of action remains not totally understood, it is hypothesized that Unifiram hampers glutamate degradation, thereby elevating synaptic glutamate levels, ultimately enhancing cognitive function.
Unifiram triggers an increase in acetylcholine release in the cerebral cortex while generating a sustained rise in the amplitude of field excitatory postsynaptic potentials (fEPSPs) in the hippocampal CA1 region.
Unifiram is a powerful nootropic compound known for its potential cognitive-enhancing properties, offering benefits like improved memory, learning, and mental clarity. Structurally similar to ampakines, Unifiram is thought to stimulate neurotransmitters in the brain, potentially increasing synaptic plasticity and promoting heightened mental performance. This nootropic is often sought by those looking to boost focus, motivation, and overall cognitive function.
| Size | 1g, 2g, 5g |
|---|
| CAS Number: | 272786-64-8 |
|---|---|
| Purity: | ≥99% |
| Molecular Weight: | 298.33 g/mol |
| Melting Point: | Unknown |
| Molecular Formula: | C13H15FN2O3S |
| Synonyms: | RS-2-[(4-fluorophenyl)sulfonyl]hexahydropyrrolo[1,2-a]pyrazin-6(2H)-one, DM-232 |
| PubChem CID: | 9861054 |
| SMILES: | C1CC(=O)N2C1CN(CC2)S(=O)(=O)C3=CC=C(C=C3)F |
| Application: | DM232 (unifiram) is a AMPAkine-like nootropic three orders of magnitude more potent than piracetam in animal studies. |
|---|---|
| Appearance: | White or off-white powder |
| Physical State: | Solid |
| Solubility: | Soluble to 5 mM in Ethanol, Sparingly soluble in Water. |
| Storage: | Store at room temperature or cooler, in a sealed airtight container, protected from heat, light and humidity. |
| Stability: | Stable for at least two years when stored as above. |
