Menu
F-Phenibut HCl (Fluorophenibut Hydrochloride) is a derivative of Phenibut, known for its potential to reduce anxiety, enhance mood, and promote relaxation. By modulating GABA receptors, it is studied for its effects on reducing stress while maintaining mental clarity and focus.
For a more detailed description and lab analysis, please see the sections below.
From €24.80
F-Phenibut HCL, Powder
F-Phenibut HCl (4-Fluorophenibut hydrochloride) is a several-fold more potent derivative of the nootropic and anxiolytic GABA derivative, Phenibut.
F-Phenibut HCl (4-Fluorophenibut hydrochloride) is a several-fold more potent derivative of Phenibut. Phenibut is an atypical anxiolytic and nootropic compound structurally similar to the well known inhibitory neurotransmitter GABA, as well as to baclofen (β-(4-chlorophenyl)-GABA) and pregabalin (β-isobutyl-GABA). Phenibut was originally thought to act solely as a selective GABAB receptor agonist, similar to its much more potent relative baclofen, but has more recently been found to additionally act with somewhat higher affinity as an inhibitor of α2δ subunit-containing voltage-gated calcium channels, a mechanism of action shared with gabapentin and pregabalin. also, you can check this product fasoracetam
Phenibut is known to have a wider spectrum of effects than baclofen; for example Phenibut has been found to be more effective as a nootropic and neuroprotective compound than baclofen, while baclofen has a more narrowly focused spectrum of effects and anecdotally shows a reduced tendency to induce habituation or tolerance to its effects upon chronic daily administration.
F-Phenibut HCl is a fluorinated analog of Phenibut, a nootropic and anxiolytic compound originally developed in Russia. The addition of a fluorine atom in F-Phenibut enhances its potency compared to Phenibut, allowing for potentially stronger effects at lower doses. Like Phenibut, F-Phenibut works by targeting the GABA-B receptors in the brain, which play a crucial role in regulating anxiety, mood, and social behavior. It may also influence dopaminergic pathways, further contributing to its mood-enhancing and calming effects. check Pinterest
F-Phenibut is often studied for its potential to promote relaxation without causing sedation, making it a popular choice for reducing anxiety while maintaining mental clarity and cognitive function. Its effects are thought to be more potent and longer-lasting compared to Phenibut due to the fluorine modification.
F-Phenibut HCl exerts its effects primarily through the GABAergic system, specifically by acting as a GABA-B receptor agonist:
As a more potent analog of Phenibut, F-Phenibut HCl should be used by individuals with caution. While it offers potential effects for reducing anxiety and enhancing mood, long-term use may lead to tolerance and dependence, especially at higher doses.
For detailed lab analysis and product specifications, please refer to the next tabs.
| CAS Number: | 1858241-03-8 |
|---|---|
| Purity: | ≥98% |
| Molecular Weight: | 233.66 g/mol |
| Melting Point: | Unknown |
| Molecular Formula: | C10FH12NO2 •HCl |
| Synonyms: | 4-Amino-3-(4-fluorophenyl)butanoic acid hydrochloride, 4-Amino-3-(4-fluorophenyl)butyric acid, 4-Fluorophenibut hydrochloride, β-(4-fluorophenyl)-γ-aminobutyric acid hydrochloride, CGP-11130, Fluorophenibut HCL, F-Phenibut, Fluoribut, Fenibut |
| PubChem CID: | 103611 |
| SMILES: | C1(F)=CC=C(C=C1)C(CC(=O)O)CN |
| Application: | F-Phenibut HCl (4-Fluorophenibut hydrochloride) is a several-fold more potent derivative of the nootropic and anxiolytic gamma amino butyric acid derivative, Phenibut; useful as a GABAB and α2δ subunit-containing voltage-gated calcium channel ligand |
|---|---|
| Appearance: | White or off-white crystalline powder |
| Physical State: | Solid |
| Solubility: | Freely soluble in Ethanol, Water. |
| Storage: | Store at room temperature or cooler, in a sealed airtight container, protected from heat, light and humidity. |
| Stability: | Stable for at least two years when stored as above. |
